C20H33NO2 — CID 38346124
(2E,4Z,7E,9E,11S)-11-hydroxy-N-(2-methylpropyl)hexadeca-2,4,7,9-tetraenamide (PubChem CID 38346124) has the molecular formula C20H33NO2 and a molecular weight of 319.49 g/mol. Its IUPAC name is (2E,4Z,7E,9E,11S)-11-hydroxy-N-(2-methylpropyl)hexadeca-2,4,7,9-tetraenamide.
| Compound Name | (2E,4Z,7E,9E,11S)-11-hydroxy-N-(2-methylpropyl)hexadeca-2,4,7,9-tetraenamide |
|---|---|
| PubChem CID | 38346124 |
| Molecular Formula | C20H33NO2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | (2E,4Z,7E,9E,11S)-11-hydroxy-N-(2-methylpropyl)hexadeca-2,4,7,9-tetraenamide |
| SMILES | CCCCC[C@H](O)/C=C/C=C/C/C=C\C=C\C(=O)NCC(C)C |
| InChI | InChI=1S/C20H33NO2/c1-4-5-11-14-19(22)15-12-9-7-6-8-10-13-16-20(23)21-17-18(2)3/h7-10,12-13,15-16,18-19,22H,4-6,11,14,17H2,1-3H3,(H,21,23)/b9-7+,10-8-,15-12+,16-13+/t19-/m0/s1 |
| InChIKey | GBIGUUMWQWNTMS-LVJHDJGHSA-N |
| XLogP | 4.31 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|