C19H33NO — CID 59903293
(2E,6Z,8E)-N-(2,2-dimethylpropyl)-10,11-dimethyldodeca-2,6,8-trienamide (PubChem CID 59903293) has the molecular formula C19H33NO and a molecular weight of 291.48 g/mol. Its IUPAC name is (2E,6Z,8E)-N-(2,2-dimethylpropyl)-10,11-dimethyldodeca-2,6,8-trienamide.
| Compound Name | (2E,6Z,8E)-N-(2,2-dimethylpropyl)-10,11-dimethyldodeca-2,6,8-trienamide |
|---|---|
| PubChem CID | 59903293 |
| Molecular Formula | C19H33NO |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 291.26 |
| IUPAC Name | (2E,6Z,8E)-N-(2,2-dimethylpropyl)-10,11-dimethyldodeca-2,6,8-trienamide |
| SMILES | CC(C)C(C)/C=C/C=C\CC/C=C/C(=O)NCC(C)(C)C |
| InChI | InChI=1S/C19H33NO/c1-16(2)17(3)13-11-9-7-8-10-12-14-18(21)20-15-19(4,5)6/h7,9,11-14,16-17H,8,10,15H2,1-6H3,(H,20,21)/b9-7-,13-11+,14-12+ |
| InChIKey | URXMZUDXVKBRDP-NSJFEFTKSA-N |
| XLogP | 4.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|