C17H26N2O2 — CID 110008146
(E)-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-2-methyl-3-(4-methylphenyl)prop-2-enamide (PubChem CID 110008146) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is (E)-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-2-methyl-3-(4-methylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-2-methyl-3-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 110008146 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | (E)-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-2-methyl-3-(4-methylphenyl)prop-2-enamide |
| SMILES | C/C(=C\c1ccc(C)cc1)C(=O)NCC(C)(O)CN(C)C |
| InChI | InChI=1S/C17H26N2O2/c1-13-6-8-15(9-7-13)10-14(2)16(20)18-11-17(3,21)12-19(4)5/h6-10,21H,11-12H2,1-5H3,(H,18,20)/b14-10+ |
| InChIKey | OPDHICQAJACKRD-GXDHUFHOSA-N |
| XLogP | 1.83 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|