C9H22N2O2 — CID 142883467
2-[2-[2-(ethylamino)ethyl-methylamino]ethoxy]ethanol (PubChem CID 142883467) has the molecular formula C9H22N2O2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 2-[2-[2-(ethylamino)ethyl-methylamino]ethoxy]ethanol.
| Compound Name | 2-[2-[2-(ethylamino)ethyl-methylamino]ethoxy]ethanol |
|---|---|
| PubChem CID | 142883467 |
| Molecular Formula | C9H22N2O2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | 2-[2-[2-(ethylamino)ethyl-methylamino]ethoxy]ethanol |
| SMILES | CCNCCN(C)CCOCCO |
| InChI | InChI=1S/C9H22N2O2/c1-3-10-4-5-11(2)6-8-13-9-7-12/h10,12H,3-9H2,1-2H3 |
| InChIKey | VBLSOOABHSJRHR-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|