About N',N'-bis(2-methoxyethyl)ethane-1,2-diamine;dihydrochloride
N',N'-bis(2-methoxyethyl)ethane-1,2-diamine;dihydrochloride (PubChem CID 86811567) has the molecular formula C8H22Cl2N2O2
and a molecular weight of 249.18 g/mol. Its IUPAC name is N',N'-bis(2-methoxyethyl)ethane-1,2-diamine;dihydrochloride.
Molecular Properties
| Compound Name | N',N'-bis(2-methoxyethyl)ethane-1,2-diamine;dihydrochloride |
| PubChem CID | 86811567 |
| Molecular Formula | C8H22Cl2N2O2 |
| Molecular Weight | 249.18 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | N',N'-bis(2-methoxyethyl)ethane-1,2-diamine;dihydrochloride |
| SMILES | COCCN(CCN)CCOC.Cl.Cl |
| InChI | InChI=1S/C8H20N2O2.2ClH/c1-11-7-5-10(4-3-9)6-8-12-2;;/h3-9H2,1-2H3;2*1H |
| InChIKey | QFTVLXQUKHCPJP-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.18 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N',N'-bis(2-methoxyethyl)ethane-1,2-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',N'-bis(2-methoxyethyl)ethane-1,2-diamine;dihydrochloride?
The IUPAC name of N',N'-bis(2-methoxyethyl)ethane-1,2-diamine;dihydrochloride (CID 86811567) is N',N'-bis(2-methoxyethyl)ethane-1,2-diamine;dihydrochloride.
What is the SMILES notation for N',N'-bis(2-methoxyethyl)ethane-1,2-diamine;dihydrochloride?
The canonical SMILES for N',N'-bis(2-methoxyethyl)ethane-1,2-diamine;dihydrochloride is COCCN(CCN)CCOC.Cl.Cl.
What is the InChIKey of N',N'-bis(2-methoxyethyl)ethane-1,2-diamine;dihydrochloride?
The InChIKey is QFTVLXQUKHCPJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20N2O2.2ClH/c1-11-7-5-10(4-3-9)6-8-12-2;;/h3-9H2,1-2H3;2*1H.
What are the key properties of N',N'-bis(2-methoxyethyl)ethane-1,2-diamine;dihydrochloride?
N',N'-bis(2-methoxyethyl)ethane-1,2-diamine;dihydrochloride has a molecular weight of 249.18 g/mol, XLogP of 0.38, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N',N'-bis(2-methoxyethyl)ethane-1,2-diamine;dihydrochloride is sourced from PubChem (CID 86811567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).