C8H18N2O2 — CID 88516176
N,N-diethylformamide;N-methylacetamide (PubChem CID 88516176) has the molecular formula C8H18N2O2 and a molecular weight of 174.24 g/mol. Its IUPAC name is N,N-diethylformamide;N-methylacetamide.
| Compound Name | N,N-diethylformamide;N-methylacetamide |
|---|---|
| PubChem CID | 88516176 |
| Molecular Formula | C8H18N2O2 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | N,N-diethylformamide;N-methylacetamide |
| SMILES | CCN(C=O)CC.CNC(C)=O |
| InChI | InChI=1S/C5H11NO.C3H7NO/c1-3-6(4-2)5-7;1-3(5)4-2/h5H,3-4H2,1-2H3;1-2H3,(H,4,5) |
| InChIKey | RHOKORAHIONNQK-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|