C13H24NORf- — CID 178150779
ethane;(2E)-N-methyl-2-prop-1-en-2-ylpenta-2,4-dienamide;rutherfordium (PubChem CID 178150779) has the molecular formula C13H24NORf- and a molecular weight of 477.34 g/mol. Its IUPAC name is ethane;(2E)-N-methyl-2-prop-1-en-2-ylpenta-2,4-dienamide;rutherfordium.
| Compound Name | ethane;(2E)-N-methyl-2-prop-1-en-2-ylpenta-2,4-dienamide;rutherfordium |
|---|---|
| PubChem CID | 178150779 |
| Molecular Formula | C13H24NORf- |
| Molecular Weight | 477.34 g/mol |
| Exact Mass | 477.31 |
| IUPAC Name | ethane;(2E)-N-methyl-2-prop-1-en-2-ylpenta-2,4-dienamide;rutherfordium |
| SMILES | C=[C-]/C=C(\C(=C)C)C(=O)NC.CC.CC.[Rf] |
| InChI | InChI=1S/C9H12NO.2C2H6.Rf/c1-5-6-8(7(2)3)9(11)10-4;2*1-2;/h6H,1-2H2,3-4H3,(H,10,11);2*1-2H3;/q-1;;;/b8-6+;;; |
| InChIKey | KJTOBGDUJNWGHA-LGSAIMRHSA-N |
| XLogP | 3.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|