C8H11BrN2O2 — CID 131970548
(2E,4Z)-5-bromo-2-ethenyl-6-hydrazinylhexa-2,4-dienoic acid (PubChem CID 131970548) has the molecular formula C8H11BrN2O2 and a molecular weight of 247.09 g/mol. Its IUPAC name is (2E,4Z)-5-bromo-2-ethenyl-6-hydrazinylhexa-2,4-dienoic acid.
| Compound Name | (2E,4Z)-5-bromo-2-ethenyl-6-hydrazinylhexa-2,4-dienoic acid |
|---|---|
| PubChem CID | 131970548 |
| Molecular Formula | C8H11BrN2O2 |
| Molecular Weight | 247.09 g/mol |
| Exact Mass | 246.00 |
| IUPAC Name | (2E,4Z)-5-bromo-2-ethenyl-6-hydrazinylhexa-2,4-dienoic acid |
| SMILES | C=C/C(=C\C=C(/Br)CNN)C(=O)O |
| InChI | InChI=1S/C8H11BrN2O2/c1-2-6(8(12)13)3-4-7(9)5-11-10/h2-4,11H,1,5,10H2,(H,12,13)/b6-3+,7-4- |
| InChIKey | LGQPQHVGFWZIDP-JOVCIAKGSA-N |
| XLogP | 0.93 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.09 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|