(2E,4E)-5-carbonochloridoyl-2-ethenylhepta-2,4,6-trienoic acid

C10H9ClO3 — CID 170252954

IUPAC(2E,4E)-5-carbonochloridoyl-2-ethenylhepta-2,4,6-trienoic acid
SMILESC=C/C(=C\C=C(/C=C)C(=O)Cl)C(=O)O
InChIInChI=1S/C10H9ClO3/c1-3-7(9(11)12)5-6-8(4-2)10(13)14/h3-6H,1-2H2,(H,13,14)/b7-5+,8-6+
InChIKeyHUBCQEFRWPTSLS-KQQUZDAGSA-N
MW212.63 g/mol
LogP2.06
Rot. Bonds5

About (2E,4E)-5-carbonochloridoyl-2-ethenylhepta-2,4,6-trienoic acid

(2E,4E)-5-carbonochloridoyl-2-ethenylhepta-2,4,6-trienoic acid (PubChem CID 170252954) has the molecular formula C10H9ClO3 and a molecular weight of 212.63 g/mol. Its IUPAC name is (2E,4E)-5-carbonochloridoyl-2-ethenylhepta-2,4,6-trienoic acid.

Molecular Properties

Compound Name(2E,4E)-5-carbonochloridoyl-2-ethenylhepta-2,4,6-trienoic acid
PubChem CID170252954
Molecular FormulaC10H9ClO3
Molecular Weight212.63 g/mol
Exact Mass212.02
IUPAC Name(2E,4E)-5-carbonochloridoyl-2-ethenylhepta-2,4,6-trienoic acid
SMILESC=C/C(=C\C=C(/C=C)C(=O)Cl)C(=O)O
InChIInChI=1S/C10H9ClO3/c1-3-7(9(11)12)5-6-8(4-2)10(13)14/h3-6H,1-2H2,(H,13,14)/b7-5+,8-6+
InChIKeyHUBCQEFRWPTSLS-KQQUZDAGSA-N
XLogP2.06
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.63
LogP ≤ 52.06
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (2E,4E)-5-carbonochloridoyl-2-ethenylhepta-2,4,6-trienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2E,4E)-5-carbonochloridoyl-2-ethenylhepta-2,4,6-trienoic acid?
The IUPAC name of (2E,4E)-5-carbonochloridoyl-2-ethenylhepta-2,4,6-trienoic acid (CID 170252954) is (2E,4E)-5-carbonochloridoyl-2-ethenylhepta-2,4,6-trienoic acid.
What is the SMILES notation for (2E,4E)-5-carbonochloridoyl-2-ethenylhepta-2,4,6-trienoic acid?
The canonical SMILES for (2E,4E)-5-carbonochloridoyl-2-ethenylhepta-2,4,6-trienoic acid is C=C/C(=C\C=C(/C=C)C(=O)Cl)C(=O)O.
What is the InChIKey of (2E,4E)-5-carbonochloridoyl-2-ethenylhepta-2,4,6-trienoic acid?
The InChIKey is HUBCQEFRWPTSLS-KQQUZDAGSA-N. The full InChI is InChI=1S/C10H9ClO3/c1-3-7(9(11)12)5-6-8(4-2)10(13)14/h3-6H,1-2H2,(H,13,14)/b7-5+,8-6+.
What are the key properties of (2E,4E)-5-carbonochloridoyl-2-ethenylhepta-2,4,6-trienoic acid?
(2E,4E)-5-carbonochloridoyl-2-ethenylhepta-2,4,6-trienoic acid has a molecular weight of 212.63 g/mol, XLogP of 2.06, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-5-carbonochloridoyl-2-ethenylhepta-2,4,6-trienoic acid is sourced from PubChem (CID 170252954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).