C10H9ClO3 — CID 170252954
(2E,4E)-5-carbonochloridoyl-2-ethenylhepta-2,4,6-trienoic acid (PubChem CID 170252954) has the molecular formula C10H9ClO3 and a molecular weight of 212.63 g/mol. Its IUPAC name is (2E,4E)-5-carbonochloridoyl-2-ethenylhepta-2,4,6-trienoic acid.
| Compound Name | (2E,4E)-5-carbonochloridoyl-2-ethenylhepta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 170252954 |
| Molecular Formula | C10H9ClO3 |
| Molecular Weight | 212.63 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | (2E,4E)-5-carbonochloridoyl-2-ethenylhepta-2,4,6-trienoic acid |
| SMILES | C=C/C(=C\C=C(/C=C)C(=O)Cl)C(=O)O |
| InChI | InChI=1S/C10H9ClO3/c1-3-7(9(11)12)5-6-8(4-2)10(13)14/h3-6H,1-2H2,(H,13,14)/b7-5+,8-6+ |
| InChIKey | HUBCQEFRWPTSLS-KQQUZDAGSA-N |
| XLogP | 2.06 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.63 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|