C17H24O — CID 123766592
5-ethylidene-3,8-dimethyl-6-methylidenedodeca-3,7,9-trien-2-one (PubChem CID 123766592) has the molecular formula C17H24O and a molecular weight of 244.38 g/mol. Its IUPAC name is 5-ethylidene-3,8-dimethyl-6-methylidenedodeca-3,7,9-trien-2-one.
| Compound Name | 5-ethylidene-3,8-dimethyl-6-methylidenedodeca-3,7,9-trien-2-one |
|---|---|
| PubChem CID | 123766592 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 5-ethylidene-3,8-dimethyl-6-methylidenedodeca-3,7,9-trien-2-one |
| SMILES | C=C(C=C(C)C=CCC)C(C=C(C)C(C)=O)=CC |
| InChI | InChI=1S/C17H24O/c1-7-9-10-13(3)11-15(5)17(8-2)12-14(4)16(6)18/h8-12H,5,7H2,1-4,6H3 |
| InChIKey | MSXSYENQDGLUID-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|