C14H24 — CID 143713346
(3Z,5Z)-5-ethyl-2,4-dimethylnona-1,3,5,8-tetraene;methane (PubChem CID 143713346) has the molecular formula C14H24 and a molecular weight of 192.35 g/mol. Its IUPAC name is (3Z,5Z)-5-ethyl-2,4-dimethylnona-1,3,5,8-tetraene;methane.
| Compound Name | (3Z,5Z)-5-ethyl-2,4-dimethylnona-1,3,5,8-tetraene;methane |
|---|---|
| PubChem CID | 143713346 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | (3Z,5Z)-5-ethyl-2,4-dimethylnona-1,3,5,8-tetraene;methane |
| SMILES | C.C=CC/C=C(CC)\C(C)=C/C(=C)C |
| InChI | InChI=1S/C13H20.CH4/c1-6-8-9-13(7-2)12(5)10-11(3)4;/h6,9-10H,1,3,7-8H2,2,4-5H3;1H4/b12-10-,13-9-; |
| InChIKey | KEBRURNMZRMBDL-SXNQYKMXSA-N |
| XLogP | 5.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|