About 2-methylprop-2-enal;propane-1-thiol
2-methylprop-2-enal;propane-1-thiol (PubChem CID 88711482) has the molecular formula C7H14OS
and a molecular weight of 146.25 g/mol. Its IUPAC name is 2-methylprop-2-enal;propane-1-thiol.
Molecular Properties
| Compound Name | 2-methylprop-2-enal;propane-1-thiol |
| PubChem CID | 88711482 |
| Molecular Formula | C7H14OS |
| Molecular Weight | 146.25 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 2-methylprop-2-enal;propane-1-thiol |
| SMILES | C=C(C)C=O.CCCS |
| InChI | InChI=1S/C4H6O.C3H8S/c1-4(2)3-5;1-2-3-4/h3H,1H2,2H3;4H,2-3H2,1H3 |
| InChIKey | HUWDLIKXVSXAPE-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-enal;propane-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-enal;propane-1-thiol?
The IUPAC name of 2-methylprop-2-enal;propane-1-thiol (CID 88711482) is 2-methylprop-2-enal;propane-1-thiol.
What is the SMILES notation for 2-methylprop-2-enal;propane-1-thiol?
The canonical SMILES for 2-methylprop-2-enal;propane-1-thiol is C=C(C)C=O.CCCS.
What is the InChIKey of 2-methylprop-2-enal;propane-1-thiol?
The InChIKey is HUWDLIKXVSXAPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O.C3H8S/c1-4(2)3-5;1-2-3-4/h3H,1H2,2H3;4H,2-3H2,1H3.
What are the key properties of 2-methylprop-2-enal;propane-1-thiol?
2-methylprop-2-enal;propane-1-thiol has a molecular weight of 146.25 g/mol, XLogP of 2.09, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-enal;propane-1-thiol is sourced from PubChem (CID 88711482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).