About propane-1-selenol;silver;trimethoxysilane
propane-1-selenol;silver;trimethoxysilane (PubChem CID 173012716) has the molecular formula C6H18AgO3SeSi
and a molecular weight of 353.12 g/mol. Its IUPAC name is propane-1-selenol;silver;trimethoxysilane.
Molecular Properties
| Compound Name | propane-1-selenol;silver;trimethoxysilane |
| PubChem CID | 173012716 |
| Molecular Formula | C6H18AgO3SeSi |
| Molecular Weight | 353.12 g/mol |
| Exact Mass | 352.92 |
| IUPAC Name | propane-1-selenol;silver;trimethoxysilane |
| SMILES | CCC[SeH].CO[SiH](OC)OC.[Ag] |
| InChI | InChI=1S/C3H10O3Si.C3H8Se.Ag/c1-4-7(5-2)6-3;1-2-3-4;/h7H,1-3H3;4H,2-3H2,1H3; |
| InChIKey | AQRPAEOEEKDRQP-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.12 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze propane-1-selenol;silver;trimethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane-1-selenol;silver;trimethoxysilane?
The IUPAC name of propane-1-selenol;silver;trimethoxysilane (CID 173012716) is propane-1-selenol;silver;trimethoxysilane.
What is the SMILES notation for propane-1-selenol;silver;trimethoxysilane?
The canonical SMILES for propane-1-selenol;silver;trimethoxysilane is CCC[SeH].CO[SiH](OC)OC.[Ag].
What is the InChIKey of propane-1-selenol;silver;trimethoxysilane?
The InChIKey is AQRPAEOEEKDRQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10O3Si.C3H8Se.Ag/c1-4-7(5-2)6-3;1-2-3-4;/h7H,1-3H3;4H,2-3H2,1H3;.
What are the key properties of propane-1-selenol;silver;trimethoxysilane?
propane-1-selenol;silver;trimethoxysilane has a molecular weight of 353.12 g/mol, XLogP of 0.36, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propane-1-selenol;silver;trimethoxysilane is sourced from PubChem (CID 173012716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).