About 3-hexan-3-yloxyhexane;trimethoxysilane
3-hexan-3-yloxyhexane;trimethoxysilane (PubChem CID 175116578) has the molecular formula C15H36O4Si
and a molecular weight of 308.53 g/mol. Its IUPAC name is 3-hexan-3-yloxyhexane;trimethoxysilane.
Molecular Properties
| Compound Name | 3-hexan-3-yloxyhexane;trimethoxysilane |
| PubChem CID | 175116578 |
| Molecular Formula | C15H36O4Si |
| Molecular Weight | 308.53 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | 3-hexan-3-yloxyhexane;trimethoxysilane |
| SMILES | CCCC(CC)OC(CC)CCC.CO[SiH](OC)OC |
| InChI | InChI=1S/C12H26O.C3H10O3Si/c1-5-9-11(7-3)13-12(8-4)10-6-2;1-4-7(5-2)6-3/h11-12H,5-10H2,1-4H3;7H,1-3H3 |
| InChIKey | ZSPBGXMABLSOJN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.53 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-hexan-3-yloxyhexane;trimethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hexan-3-yloxyhexane;trimethoxysilane?
The IUPAC name of 3-hexan-3-yloxyhexane;trimethoxysilane (CID 175116578) is 3-hexan-3-yloxyhexane;trimethoxysilane.
What is the SMILES notation for 3-hexan-3-yloxyhexane;trimethoxysilane?
The canonical SMILES for 3-hexan-3-yloxyhexane;trimethoxysilane is CCCC(CC)OC(CC)CCC.CO[SiH](OC)OC.
What is the InChIKey of 3-hexan-3-yloxyhexane;trimethoxysilane?
The InChIKey is ZSPBGXMABLSOJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O.C3H10O3Si/c1-5-9-11(7-3)13-12(8-4)10-6-2;1-4-7(5-2)6-3/h11-12H,5-10H2,1-4H3;7H,1-3H3.
What are the key properties of 3-hexan-3-yloxyhexane;trimethoxysilane?
3-hexan-3-yloxyhexane;trimethoxysilane has a molecular weight of 308.53 g/mol, XLogP of 3.80, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hexan-3-yloxyhexane;trimethoxysilane is sourced from PubChem (CID 175116578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).