About 2-pentan-3-yloxypentane
2-pentan-3-yloxypentane (PubChem CID 91256227) has the molecular formula C10H22O
and a molecular weight of 158.28 g/mol. Its IUPAC name is 2-pentan-3-yloxypentane.
Molecular Properties
| Compound Name | 2-pentan-3-yloxypentane |
| PubChem CID | 91256227 |
| Molecular Formula | C10H22O |
| Molecular Weight | 158.28 g/mol |
| Exact Mass | 158.17 |
| IUPAC Name | 2-pentan-3-yloxypentane |
| SMILES | CCCC(C)OC(CC)CC |
| InChI | InChI=1S/C10H22O/c1-5-8-9(4)11-10(6-2)7-3/h9-10H,5-8H2,1-4H3 |
| InChIKey | OOCXVJMRZUSSOR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.28 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-pentan-3-yloxypentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pentan-3-yloxypentane?
The IUPAC name of 2-pentan-3-yloxypentane (CID 91256227) is 2-pentan-3-yloxypentane.
What is the SMILES notation for 2-pentan-3-yloxypentane?
The canonical SMILES for 2-pentan-3-yloxypentane is CCCC(C)OC(CC)CC.
What is the InChIKey of 2-pentan-3-yloxypentane?
The InChIKey is OOCXVJMRZUSSOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O/c1-5-8-9(4)11-10(6-2)7-3/h9-10H,5-8H2,1-4H3.
What are the key properties of 2-pentan-3-yloxypentane?
2-pentan-3-yloxypentane has a molecular weight of 158.28 g/mol, XLogP of 3.38, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pentan-3-yloxypentane is sourced from PubChem (CID 91256227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).