C10H23NO — CID 126707201
N,N-dimethyl-2-pentan-3-yloxypropan-1-amine (PubChem CID 126707201) has the molecular formula C10H23NO and a molecular weight of 173.30 g/mol. Its IUPAC name is N,N-dimethyl-2-pentan-3-yloxypropan-1-amine.
| Compound Name | N,N-dimethyl-2-pentan-3-yloxypropan-1-amine |
|---|---|
| PubChem CID | 126707201 |
| Molecular Formula | C10H23NO |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.18 |
| IUPAC Name | N,N-dimethyl-2-pentan-3-yloxypropan-1-amine |
| SMILES | CCC(CC)OC(C)CN(C)C |
| InChI | InChI=1S/C10H23NO/c1-6-10(7-2)12-9(3)8-11(4)5/h9-10H,6-8H2,1-5H3 |
| InChIKey | VUCLPWWEISXXDU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |