C14H30O2 — CID 175258426
3,6-di(propan-2-yloxy)octane (PubChem CID 175258426) has the molecular formula C14H30O2 and a molecular weight of 230.39 g/mol. Its IUPAC name is 3,6-di(propan-2-yloxy)octane.
| Compound Name | 3,6-di(propan-2-yloxy)octane |
|---|---|
| PubChem CID | 175258426 |
| Molecular Formula | C14H30O2 |
| Molecular Weight | 230.39 g/mol |
| Exact Mass | 230.22 |
| IUPAC Name | 3,6-di(propan-2-yloxy)octane |
| SMILES | CCC(CCC(CC)OC(C)C)OC(C)C |
| InChI | InChI=1S/C14H30O2/c1-7-13(15-11(3)4)9-10-14(8-2)16-12(5)6/h11-14H,7-10H2,1-6H3 |
| InChIKey | QRLGPEGBKJUEIC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.39 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |