About cyanic acid;3-methoxyhexane
cyanic acid;3-methoxyhexane (PubChem CID 88754292) has the molecular formula C8H17NO2
and a molecular weight of 159.23 g/mol. Its IUPAC name is cyanic acid;3-methoxyhexane.
Molecular Properties
| Compound Name | cyanic acid;3-methoxyhexane |
| PubChem CID | 88754292 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | cyanic acid;3-methoxyhexane |
| SMILES | CCCC(CC)OC.N#CO |
| InChI | InChI=1S/C7H16O.CHNO/c1-4-6-7(5-2)8-3;2-1-3/h7H,4-6H2,1-3H3;3H |
| InChIKey | VWFAGFPDLSDGHF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze cyanic acid;3-methoxyhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyanic acid;3-methoxyhexane?
The IUPAC name of cyanic acid;3-methoxyhexane (CID 88754292) is cyanic acid;3-methoxyhexane.
What is the SMILES notation for cyanic acid;3-methoxyhexane?
The canonical SMILES for cyanic acid;3-methoxyhexane is CCCC(CC)OC.N#CO.
What is the InChIKey of cyanic acid;3-methoxyhexane?
The InChIKey is VWFAGFPDLSDGHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16O.CHNO/c1-4-6-7(5-2)8-3;2-1-3/h7H,4-6H2,1-3H3;3H.
What are the key properties of cyanic acid;3-methoxyhexane?
cyanic acid;3-methoxyhexane has a molecular weight of 159.23 g/mol, XLogP of 2.05, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyanic acid;3-methoxyhexane is sourced from PubChem (CID 88754292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).