C15H29N — CID 135772574
(2S,4S,6S)-2,4,6,8-tetramethylundecanenitrile (PubChem CID 135772574) has the molecular formula C15H29N and a molecular weight of 223.40 g/mol. Its IUPAC name is (2S,4S,6S)-2,4,6,8-tetramethylundecanenitrile.
| Compound Name | (2S,4S,6S)-2,4,6,8-tetramethylundecanenitrile |
|---|---|
| PubChem CID | 135772574 |
| Molecular Formula | C15H29N |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.23 |
| IUPAC Name | (2S,4S,6S)-2,4,6,8-tetramethylundecanenitrile |
| SMILES | CCCC(C)C[C@H](C)C[C@H](C)C[C@H](C)C#N |
| InChI | InChI=1S/C15H29N/c1-6-7-12(2)8-13(3)9-14(4)10-15(5)11-16/h12-15H,6-10H2,1-5H3/t12?,13-,14-,15-/m0/s1 |
| InChIKey | BVKDUWRLFYCNEH-WLUIXCMPSA-N |
| XLogP | 5.02 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |