C13H28O2 — CID 91142814
4-ethyl-2,7-dimethylnonane-1,9-diol (PubChem CID 91142814) has the molecular formula C13H28O2 and a molecular weight of 216.36 g/mol. Its IUPAC name is 4-ethyl-2,7-dimethylnonane-1,9-diol.
| Compound Name | 4-ethyl-2,7-dimethylnonane-1,9-diol |
|---|---|
| PubChem CID | 91142814 |
| Molecular Formula | C13H28O2 |
| Molecular Weight | 216.36 g/mol |
| Exact Mass | 216.21 |
| IUPAC Name | 4-ethyl-2,7-dimethylnonane-1,9-diol |
| SMILES | CCC(CCC(C)CCO)CC(C)CO |
| InChI | InChI=1S/C13H28O2/c1-4-13(9-12(3)10-15)6-5-11(2)7-8-14/h11-15H,4-10H2,1-3H3 |
| InChIKey | HWLRIZWFXFOMIW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |