About sodium;[acetyl(phenoxy)amino]methyl-hydroxy-oxophosphanium;hydride
sodium;[acetyl(phenoxy)amino]methyl-hydroxy-oxophosphanium;hydride (PubChem CID 175412657) has the molecular formula C9H12NNaO4P+
and a molecular weight of 252.16 g/mol. Its IUPAC name is sodium;[acetyl(phenoxy)amino]methyl-hydroxy-oxophosphanium;hydride.
Molecular Properties
| Compound Name | sodium;[acetyl(phenoxy)amino]methyl-hydroxy-oxophosphanium;hydride |
| PubChem CID | 175412657 |
| Molecular Formula | C9H12NNaO4P+ |
| Molecular Weight | 252.16 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | sodium;[acetyl(phenoxy)amino]methyl-hydroxy-oxophosphanium;hydride |
| SMILES | CC(=O)N(C[P+](=O)O)Oc1ccccc1.[H-].[Na+] |
| InChI | InChI=1S/C9H10NO4P.Na.H/c1-8(11)10(7-15(12)13)14-9-5-3-2-4-6-9;;/h2-6H,7H2,1H3;;/q;+1;-1/p+1 |
| InChIKey | DZRDLFRXUZRCOD-UHFFFAOYSA-O |
| XLogP | -1.36 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.16 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium;[acetyl(phenoxy)amino]methyl-hydroxy-oxophosphanium;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;[acetyl(phenoxy)amino]methyl-hydroxy-oxophosphanium;hydride?
The IUPAC name of sodium;[acetyl(phenoxy)amino]methyl-hydroxy-oxophosphanium;hydride (CID 175412657) is sodium;[acetyl(phenoxy)amino]methyl-hydroxy-oxophosphanium;hydride.
What is the SMILES notation for sodium;[acetyl(phenoxy)amino]methyl-hydroxy-oxophosphanium;hydride?
The canonical SMILES for sodium;[acetyl(phenoxy)amino]methyl-hydroxy-oxophosphanium;hydride is CC(=O)N(C[P+](=O)O)Oc1ccccc1.[H-].[Na+].
What is the InChIKey of sodium;[acetyl(phenoxy)amino]methyl-hydroxy-oxophosphanium;hydride?
The InChIKey is DZRDLFRXUZRCOD-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H10NO4P.Na.H/c1-8(11)10(7-15(12)13)14-9-5-3-2-4-6-9;;/h2-6H,7H2,1H3;;/q;+1;-1/p+1.
What are the key properties of sodium;[acetyl(phenoxy)amino]methyl-hydroxy-oxophosphanium;hydride?
sodium;[acetyl(phenoxy)amino]methyl-hydroxy-oxophosphanium;hydride has a molecular weight of 252.16 g/mol, XLogP of -1.36, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;[acetyl(phenoxy)amino]methyl-hydroxy-oxophosphanium;hydride is sourced from PubChem (CID 175412657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).