C20H20N2O3S3 — CID 24511008
4-(2-oxopyrrolidin-1-yl)-N,N-bis(thiophen-2-ylmethyl)benzenesulfonamide (PubChem CID 24511008) has the molecular formula C20H20N2O3S3 and a molecular weight of 432.59 g/mol. Its IUPAC name is 4-(2-oxopyrrolidin-1-yl)-N,N-bis(thiophen-2-ylmethyl)benzenesulfonamide.
| Compound Name | 4-(2-oxopyrrolidin-1-yl)-N,N-bis(thiophen-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 24511008 |
| Molecular Formula | C20H20N2O3S3 |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | 4-(2-oxopyrrolidin-1-yl)-N,N-bis(thiophen-2-ylmethyl)benzenesulfonamide |
| SMILES | O=C1CCCN1c1ccc(S(=O)(=O)N(Cc2cccs2)Cc2cccs2)cc1 |
| InChI | InChI=1S/C20H20N2O3S3/c23-20-6-1-11-22(20)16-7-9-19(10-8-16)28(24,25)21(14-17-4-2-12-26-17)15-18-5-3-13-27-18/h2-5,7-10,12-13H,1,6,11,14-15H2 |
| InChIKey | CJROYGGQGJXGPX-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |