C18H28N2O3S — CID 2249244
N,N-dibutyl-4-(2-oxopyrrolidin-1-yl)benzenesulfonamide (PubChem CID 2249244) has the molecular formula C18H28N2O3S and a molecular weight of 352.50 g/mol. Its IUPAC name is N,N-dibutyl-4-(2-oxopyrrolidin-1-yl)benzenesulfonamide.
| Compound Name | N,N-dibutyl-4-(2-oxopyrrolidin-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 2249244 |
| Molecular Formula | C18H28N2O3S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | N,N-dibutyl-4-(2-oxopyrrolidin-1-yl)benzenesulfonamide |
| SMILES | CCCCN(CCCC)S(=O)(=O)c1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C18H28N2O3S/c1-3-5-13-19(14-6-4-2)24(22,23)17-11-9-16(10-12-17)20-15-7-8-18(20)21/h9-12H,3-8,13-15H2,1-2H3 |
| InChIKey | MFGQTJZECGAQGC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |