C24H28N4O4S — CID 19614312
4-(2-oxopyrrolidin-1-yl)-N-pentyl-N-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]benzenesulfonamide (PubChem CID 19614312) has the molecular formula C24H28N4O4S and a molecular weight of 468.58 g/mol. Its IUPAC name is 4-(2-oxopyrrolidin-1-yl)-N-pentyl-N-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]benzenesulfonamide.
| Compound Name | 4-(2-oxopyrrolidin-1-yl)-N-pentyl-N-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 19614312 |
| Molecular Formula | C24H28N4O4S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 4-(2-oxopyrrolidin-1-yl)-N-pentyl-N-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]benzenesulfonamide |
| SMILES | CCCCCN(Cc1nnc(-c2ccccc2)o1)S(=O)(=O)c1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C24H28N4O4S/c1-2-3-7-16-27(18-22-25-26-24(32-22)19-9-5-4-6-10-19)33(30,31)21-14-12-20(13-15-21)28-17-8-11-23(28)29/h4-6,9-10,12-15H,2-3,7-8,11,16-18H2,1H3 |
| InChIKey | PWWLFUVCXAFYTE-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 96.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|