C22H26N4O5S — CID 31829154
4-[3-[ethyl-[4-(2-oxopyrrolidin-1-yl)phenyl]sulfonylamino]propanoylamino]benzamide (PubChem CID 31829154) has the molecular formula C22H26N4O5S and a molecular weight of 458.54 g/mol. Its IUPAC name is 4-[3-[ethyl-[4-(2-oxopyrrolidin-1-yl)phenyl]sulfonylamino]propanoylamino]benzamide.
| Compound Name | 4-[3-[ethyl-[4-(2-oxopyrrolidin-1-yl)phenyl]sulfonylamino]propanoylamino]benzamide |
|---|---|
| PubChem CID | 31829154 |
| Molecular Formula | C22H26N4O5S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 4-[3-[ethyl-[4-(2-oxopyrrolidin-1-yl)phenyl]sulfonylamino]propanoylamino]benzamide |
| SMILES | CCN(CCC(=O)Nc1ccc(C(N)=O)cc1)S(=O)(=O)c1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C22H26N4O5S/c1-2-25(15-13-20(27)24-17-7-5-16(6-8-17)22(23)29)32(30,31)19-11-9-18(10-12-19)26-14-3-4-21(26)28/h5-12H,2-4,13-15H2,1H3,(H2,23,29)(H,24,27) |
| InChIKey | UWQCIUIURVHBEG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 129.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |