C19H21N3O4S2 — CID 9180389
N-(4-methylsulfanylphenyl)-2-[[4-(2-oxopyrrolidin-1-yl)phenyl]sulfonylamino]acetamide (PubChem CID 9180389) has the molecular formula C19H21N3O4S2 and a molecular weight of 419.53 g/mol. Its IUPAC name is N-(4-methylsulfanylphenyl)-2-[[4-(2-oxopyrrolidin-1-yl)phenyl]sulfonylamino]acetamide.
| Compound Name | N-(4-methylsulfanylphenyl)-2-[[4-(2-oxopyrrolidin-1-yl)phenyl]sulfonylamino]acetamide |
|---|---|
| PubChem CID | 9180389 |
| Molecular Formula | C19H21N3O4S2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | N-(4-methylsulfanylphenyl)-2-[[4-(2-oxopyrrolidin-1-yl)phenyl]sulfonylamino]acetamide |
| SMILES | CSc1ccc(NC(=O)CNS(=O)(=O)c2ccc(N3CCCC3=O)cc2)cc1 |
| InChI | InChI=1S/C19H21N3O4S2/c1-27-16-8-4-14(5-9-16)21-18(23)13-20-28(25,26)17-10-6-15(7-11-17)22-12-2-3-19(22)24/h4-11,20H,2-3,12-13H2,1H3,(H,21,23) |
| InChIKey | CMEJPFYRMWJYGF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |