C20H23NO5S — CID 44541126
methyl 4-[[[(Z)-4-hydroxybut-2-enyl]-(4-methylphenyl)sulfonylamino]methyl]benzoate (PubChem CID 44541126) has the molecular formula C20H23NO5S and a molecular weight of 389.47 g/mol. Its IUPAC name is methyl 4-[[[(Z)-4-hydroxybut-2-enyl]-(4-methylphenyl)sulfonylamino]methyl]benzoate.
| Compound Name | methyl 4-[[[(Z)-4-hydroxybut-2-enyl]-(4-methylphenyl)sulfonylamino]methyl]benzoate |
|---|---|
| PubChem CID | 44541126 |
| Molecular Formula | C20H23NO5S |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | methyl 4-[[[(Z)-4-hydroxybut-2-enyl]-(4-methylphenyl)sulfonylamino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN(C/C=C\CO)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C20H23NO5S/c1-16-5-11-19(12-6-16)27(24,25)21(13-3-4-14-22)15-17-7-9-18(10-8-17)20(23)26-2/h3-12,22H,13-15H2,1-2H3/b4-3- |
| InChIKey | RLSPVGSSUXBBIV-ARJAWSKDSA-N |
| XLogP | 2.52 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|