C26H27BrClN3O4S — CID 126080311
N-[(4-bromophenyl)methyl]-4-chloro-N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]benzenesulfonamide (PubChem CID 126080311) has the molecular formula C26H27BrClN3O4S and a molecular weight of 592.94 g/mol. Its IUPAC name is N-[(4-bromophenyl)methyl]-4-chloro-N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]benzenesulfonamide.
| Compound Name | N-[(4-bromophenyl)methyl]-4-chloro-N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 126080311 |
| Molecular Formula | C26H27BrClN3O4S |
| Molecular Weight | 592.94 g/mol |
| Exact Mass | 591.06 |
| IUPAC Name | N-[(4-bromophenyl)methyl]-4-chloro-N-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]benzenesulfonamide |
| SMILES | COc1ccc(N2CCN(C(=O)CN(Cc3ccc(Br)cc3)S(=O)(=O)c3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C26H27BrClN3O4S/c1-35-24-10-8-23(9-11-24)29-14-16-30(17-15-29)26(32)19-31(18-20-2-4-21(27)5-3-20)36(33,34)25-12-6-22(28)7-13-25/h2-13H,14-19H2,1H3 |
| InChIKey | UWBOKTOPFUHUMT-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.94 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|