C19H23BrCl2N2O2 — CID 68930763
2-[4-[(R)-(4-bromophenyl)-phenylmethyl]piperazin-1-yl]acetic acid;dihydrochloride (PubChem CID 68930763) has the molecular formula C19H23BrCl2N2O2 and a molecular weight of 462.22 g/mol. Its IUPAC name is 2-[4-[(R)-(4-bromophenyl)-phenylmethyl]piperazin-1-yl]acetic acid;dihydrochloride.
| Compound Name | 2-[4-[(R)-(4-bromophenyl)-phenylmethyl]piperazin-1-yl]acetic acid;dihydrochloride |
|---|---|
| PubChem CID | 68930763 |
| Molecular Formula | C19H23BrCl2N2O2 |
| Molecular Weight | 462.22 g/mol |
| Exact Mass | 460.03 |
| IUPAC Name | 2-[4-[(R)-(4-bromophenyl)-phenylmethyl]piperazin-1-yl]acetic acid;dihydrochloride |
| SMILES | Cl.Cl.O=C(O)CN1CCN([C@H](c2ccccc2)c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C19H21BrN2O2.2ClH/c20-17-8-6-16(7-9-17)19(15-4-2-1-3-5-15)22-12-10-21(11-13-22)14-18(23)24;;/h1-9,19H,10-14H2,(H,23,24);2*1H/t19-;;/m1../s1 |
| InChIKey | LYDIGTFZGYGRRI-JQDLGSOUSA-N |
| XLogP | 4.08 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.22 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |