C23H23BrN2OS — CID 92769392
1-[4-[(R)-(4-bromophenyl)-phenylmethyl]piperazin-1-yl]-2-thiophen-2-ylethanone (PubChem CID 92769392) has the molecular formula C23H23BrN2OS and a molecular weight of 455.42 g/mol. Its IUPAC name is 1-[4-[(R)-(4-bromophenyl)-phenylmethyl]piperazin-1-yl]-2-thiophen-2-ylethanone.
| Compound Name | 1-[4-[(R)-(4-bromophenyl)-phenylmethyl]piperazin-1-yl]-2-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 92769392 |
| Molecular Formula | C23H23BrN2OS |
| Molecular Weight | 455.42 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | 1-[4-[(R)-(4-bromophenyl)-phenylmethyl]piperazin-1-yl]-2-thiophen-2-ylethanone |
| SMILES | O=C(Cc1cccs1)N1CCN([C@H](c2ccccc2)c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C23H23BrN2OS/c24-20-10-8-19(9-11-20)23(18-5-2-1-3-6-18)26-14-12-25(13-15-26)22(27)17-21-7-4-16-28-21/h1-11,16,23H,12-15,17H2/t23-/m1/s1 |
| InChIKey | MZSFLOFWNRTZCD-HSZRJFAPSA-N |
| XLogP | 4.99 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.42 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |