C25H25BrN2O2 — CID 92769784
[4-[(R)-(4-bromophenyl)-phenylmethyl]piperazin-1-yl]-(3-methoxyphenyl)methanone (PubChem CID 92769784) has the molecular formula C25H25BrN2O2 and a molecular weight of 465.39 g/mol. Its IUPAC name is [4-[(R)-(4-bromophenyl)-phenylmethyl]piperazin-1-yl]-(3-methoxyphenyl)methanone.
| Compound Name | [4-[(R)-(4-bromophenyl)-phenylmethyl]piperazin-1-yl]-(3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 92769784 |
| Molecular Formula | C25H25BrN2O2 |
| Molecular Weight | 465.39 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | [4-[(R)-(4-bromophenyl)-phenylmethyl]piperazin-1-yl]-(3-methoxyphenyl)methanone |
| SMILES | COc1cccc(C(=O)N2CCN([C@H](c3ccccc3)c3ccc(Br)cc3)CC2)c1 |
| InChI | InChI=1S/C25H25BrN2O2/c1-30-23-9-5-8-21(18-23)25(29)28-16-14-27(15-17-28)24(19-6-3-2-4-7-19)20-10-12-22(26)13-11-20/h2-13,18,24H,14-17H2,1H3/t24-/m1/s1 |
| InChIKey | WIDJHWQWSFGWOJ-XMMPIXPASA-N |
| XLogP | 5.01 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.39 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |