C16H26ClN3O3S2 — CID 55437151
2-[butyl(ethyl)amino]-1-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]ethanone (PubChem CID 55437151) has the molecular formula C16H26ClN3O3S2 and a molecular weight of 407.99 g/mol. Its IUPAC name is 2-[butyl(ethyl)amino]-1-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]ethanone.
| Compound Name | 2-[butyl(ethyl)amino]-1-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 55437151 |
| Molecular Formula | C16H26ClN3O3S2 |
| Molecular Weight | 407.99 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 2-[butyl(ethyl)amino]-1-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]ethanone |
| SMILES | CCCCN(CC)CC(=O)N1CCN(S(=O)(=O)c2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C16H26ClN3O3S2/c1-3-5-8-18(4-2)13-15(21)19-9-11-20(12-10-19)25(22,23)16-7-6-14(17)24-16/h6-7H,3-5,8-13H2,1-2H3 |
| InChIKey | NUMXKSLRFKUWBZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.99 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |