C13H19N3O4S2 — CID 154774764
1-[5-(acetamidomethyl)thiophen-2-yl]sulfonylpiperidine-4-carboxamide (PubChem CID 154774764) has the molecular formula C13H19N3O4S2 and a molecular weight of 345.45 g/mol. Its IUPAC name is 1-[5-(acetamidomethyl)thiophen-2-yl]sulfonylpiperidine-4-carboxamide.
| Compound Name | 1-[5-(acetamidomethyl)thiophen-2-yl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 154774764 |
| Molecular Formula | C13H19N3O4S2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 1-[5-(acetamidomethyl)thiophen-2-yl]sulfonylpiperidine-4-carboxamide |
| SMILES | CC(=O)NCc1ccc(S(=O)(=O)N2CCC(C(N)=O)CC2)s1 |
| InChI | InChI=1S/C13H19N3O4S2/c1-9(17)15-8-11-2-3-12(21-11)22(19,20)16-6-4-10(5-7-16)13(14)18/h2-3,10H,4-8H2,1H3,(H2,14,18)(H,15,17) |
| InChIKey | WHPUVDYFFDXFFF-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |