C21H27ClN2O5S2 — CID 90840785
(1-carbamoyl-2-adamantyl) 1-(5-chlorothiophen-2-yl)sulfonylpiperidine-4-carboxylate (PubChem CID 90840785) has the molecular formula C21H27ClN2O5S2 and a molecular weight of 487.04 g/mol. Its IUPAC name is (1-carbamoyl-2-adamantyl) 1-(5-chlorothiophen-2-yl)sulfonylpiperidine-4-carboxylate.
| Compound Name | (1-carbamoyl-2-adamantyl) 1-(5-chlorothiophen-2-yl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 90840785 |
| Molecular Formula | C21H27ClN2O5S2 |
| Molecular Weight | 487.04 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | (1-carbamoyl-2-adamantyl) 1-(5-chlorothiophen-2-yl)sulfonylpiperidine-4-carboxylate |
| SMILES | NC(=O)C12CC3CC(CC(C3)C1OC(=O)C1CCN(S(=O)(=O)c3ccc(Cl)s3)CC1)C2 |
| InChI | InChI=1S/C21H27ClN2O5S2/c22-16-1-2-17(30-16)31(27,28)24-5-3-14(4-6-24)19(25)29-18-15-8-12-7-13(9-15)11-21(18,10-12)20(23)26/h1-2,12-15,18H,3-11H2,(H2,23,26) |
| InChIKey | OMAJTQIDOSNQGV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.04 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |