C16H25NO8S2 — CID 21006790
(3S,4R)-N-(2,2-dimethoxyethyl)-4-(3,4-dimethoxyphenyl)sulfonyl-1,1-dioxothiolan-3-amine (PubChem CID 21006790) has the molecular formula C16H25NO8S2 and a molecular weight of 423.51 g/mol. Its IUPAC name is (3S,4R)-N-(2,2-dimethoxyethyl)-4-(3,4-dimethoxyphenyl)sulfonyl-1,1-dioxothiolan-3-amine.
| Compound Name | (3S,4R)-N-(2,2-dimethoxyethyl)-4-(3,4-dimethoxyphenyl)sulfonyl-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 21006790 |
| Molecular Formula | C16H25NO8S2 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | (3S,4R)-N-(2,2-dimethoxyethyl)-4-(3,4-dimethoxyphenyl)sulfonyl-1,1-dioxothiolan-3-amine |
| SMILES | COc1ccc(S(=O)(=O)[C@H]2CS(=O)(=O)C[C@@H]2NCC(OC)OC)cc1OC |
| InChI | InChI=1S/C16H25NO8S2/c1-22-13-6-5-11(7-14(13)23-2)27(20,21)15-10-26(18,19)9-12(15)17-8-16(24-3)25-4/h5-7,12,15-17H,8-10H2,1-4H3/t12-,15-/m0/s1 |
| InChIKey | WRJKSZDAJPOZOH-WFASDCNBSA-N |
| XLogP | -0.15 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|