C15H20N2O4S — CID 102566602
N-[4-[benzyl(formyl)amino]-1,1-dioxothiolan-3-yl]propanamide (PubChem CID 102566602) has the molecular formula C15H20N2O4S and a molecular weight of 324.40 g/mol. Its IUPAC name is N-[4-[benzyl(formyl)amino]-1,1-dioxothiolan-3-yl]propanamide.
| Compound Name | N-[4-[benzyl(formyl)amino]-1,1-dioxothiolan-3-yl]propanamide |
|---|---|
| PubChem CID | 102566602 |
| Molecular Formula | C15H20N2O4S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | N-[4-[benzyl(formyl)amino]-1,1-dioxothiolan-3-yl]propanamide |
| SMILES | CCC(=O)NC1CS(=O)(=O)CC1N(C=O)Cc1ccccc1 |
| InChI | InChI=1S/C15H20N2O4S/c1-2-15(19)16-13-9-22(20,21)10-14(13)17(11-18)8-12-6-4-3-5-7-12/h3-7,11,13-14H,2,8-10H2,1H3,(H,16,19) |
| InChIKey | QBKJSZMRVCWABV-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|