About N-[(1S,2S)-2-[benzyl(methyl)amino]cyclohexyl]-2-chloroacetamide
N-[(1S,2S)-2-[benzyl(methyl)amino]cyclohexyl]-2-chloroacetamide (PubChem CID 96554193) has the molecular formula C16H23ClN2O
and a molecular weight of 294.83 g/mol. Its IUPAC name is N-[(1S,2S)-2-[benzyl(methyl)amino]cyclohexyl]-2-chloroacetamide.
Molecular Properties
| Compound Name | N-[(1S,2S)-2-[benzyl(methyl)amino]cyclohexyl]-2-chloroacetamide |
| PubChem CID | 96554193 |
| Molecular Formula | C16H23ClN2O |
| Molecular Weight | 294.83 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | N-[(1S,2S)-2-[benzyl(methyl)amino]cyclohexyl]-2-chloroacetamide |
| SMILES | CN(Cc1ccccc1)[C@H]1CCCC[C@@H]1NC(=O)CCl |
| InChI | InChI=1S/C16H23ClN2O/c1-19(12-13-7-3-2-4-8-13)15-10-6-5-9-14(15)18-16(20)11-17/h2-4,7-8,14-15H,5-6,9-12H2,1H3,(H,18,20)/t14-,15-/m0/s1 |
| InChIKey | PDRDKSNPCXMMAJ-GJZGRUSLSA-N |
| XLogP | 2.78 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.83 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-[(1S,2S)-2-[benzyl(methyl)amino]cyclohexyl]-2-chloroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S,2S)-2-[benzyl(methyl)amino]cyclohexyl]-2-chloroacetamide?
The IUPAC name of N-[(1S,2S)-2-[benzyl(methyl)amino]cyclohexyl]-2-chloroacetamide (CID 96554193) is N-[(1S,2S)-2-[benzyl(methyl)amino]cyclohexyl]-2-chloroacetamide.
What is the SMILES notation for N-[(1S,2S)-2-[benzyl(methyl)amino]cyclohexyl]-2-chloroacetamide?
The canonical SMILES for N-[(1S,2S)-2-[benzyl(methyl)amino]cyclohexyl]-2-chloroacetamide is CN(Cc1ccccc1)[C@H]1CCCC[C@@H]1NC(=O)CCl.
What is the InChIKey of N-[(1S,2S)-2-[benzyl(methyl)amino]cyclohexyl]-2-chloroacetamide?
The InChIKey is PDRDKSNPCXMMAJ-GJZGRUSLSA-N. The full InChI is InChI=1S/C16H23ClN2O/c1-19(12-13-7-3-2-4-8-13)15-10-6-5-9-14(15)18-16(20)11-17/h2-4,7-8,14-15H,5-6,9-12H2,1H3,(H,18,20)/t14-,15-/m0/s1.
What are the key properties of N-[(1S,2S)-2-[benzyl(methyl)amino]cyclohexyl]-2-chloroacetamide?
N-[(1S,2S)-2-[benzyl(methyl)amino]cyclohexyl]-2-chloroacetamide has a molecular weight of 294.83 g/mol, XLogP of 2.78, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S,2S)-2-[benzyl(methyl)amino]cyclohexyl]-2-chloroacetamide is sourced from PubChem (CID 96554193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).