C16H23ClN2O — CID 124526886
N-[(1R,2R)-2-[benzyl(methyl)amino]cyclohexyl]-2-chloroacetamide (PubChem CID 124526886) has the molecular formula C16H23ClN2O and a molecular weight of 294.83 g/mol. Its IUPAC name is N-[(1R,2R)-2-[benzyl(methyl)amino]cyclohexyl]-2-chloroacetamide.
| Compound Name | N-[(1R,2R)-2-[benzyl(methyl)amino]cyclohexyl]-2-chloroacetamide |
|---|---|
| PubChem CID | 124526886 |
| Molecular Formula | C16H23ClN2O |
| Molecular Weight | 294.83 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | N-[(1R,2R)-2-[benzyl(methyl)amino]cyclohexyl]-2-chloroacetamide |
| SMILES | CN(Cc1ccccc1)[C@@H]1CCCC[C@H]1NC(=O)CCl |
| InChI | InChI=1S/C16H23ClN2O/c1-19(12-13-7-3-2-4-8-13)15-10-6-5-9-14(15)18-16(20)11-17/h2-4,7-8,14-15H,5-6,9-12H2,1H3,(H,18,20)/t14-,15-/m1/s1 |
| InChIKey | PDRDKSNPCXMMAJ-HUUCEWRRSA-N |
| XLogP | 2.78 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.83 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|