About 2-amino-N-[(1S,2R)-2-[benzyl(methyl)amino]cyclohexyl]acetamide
2-amino-N-[(1S,2R)-2-[benzyl(methyl)amino]cyclohexyl]acetamide (PubChem CID 96554230) has the molecular formula C16H25N3O
and a molecular weight of 275.40 g/mol. Its IUPAC name is 2-amino-N-[(1S,2R)-2-[benzyl(methyl)amino]cyclohexyl]acetamide.
Molecular Properties
| Compound Name | 2-amino-N-[(1S,2R)-2-[benzyl(methyl)amino]cyclohexyl]acetamide |
| PubChem CID | 96554230 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | 2-amino-N-[(1S,2R)-2-[benzyl(methyl)amino]cyclohexyl]acetamide |
| SMILES | CN(Cc1ccccc1)[C@@H]1CCCC[C@@H]1NC(=O)CN |
| InChI | InChI=1S/C16H25N3O/c1-19(12-13-7-3-2-4-8-13)15-10-6-5-9-14(15)18-16(20)11-17/h2-4,7-8,14-15H,5-6,9-12,17H2,1H3,(H,18,20)/t14-,15+/m0/s1 |
| InChIKey | IVYFRJJQWNLGJP-LSDHHAIUSA-N |
| XLogP | 1.50 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-N-[(1S,2R)-2-[benzyl(methyl)amino]cyclohexyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-[(1S,2R)-2-[benzyl(methyl)amino]cyclohexyl]acetamide?
The IUPAC name of 2-amino-N-[(1S,2R)-2-[benzyl(methyl)amino]cyclohexyl]acetamide (CID 96554230) is 2-amino-N-[(1S,2R)-2-[benzyl(methyl)amino]cyclohexyl]acetamide.
What is the SMILES notation for 2-amino-N-[(1S,2R)-2-[benzyl(methyl)amino]cyclohexyl]acetamide?
The canonical SMILES for 2-amino-N-[(1S,2R)-2-[benzyl(methyl)amino]cyclohexyl]acetamide is CN(Cc1ccccc1)[C@@H]1CCCC[C@@H]1NC(=O)CN.
What is the InChIKey of 2-amino-N-[(1S,2R)-2-[benzyl(methyl)amino]cyclohexyl]acetamide?
The InChIKey is IVYFRJJQWNLGJP-LSDHHAIUSA-N. The full InChI is InChI=1S/C16H25N3O/c1-19(12-13-7-3-2-4-8-13)15-10-6-5-9-14(15)18-16(20)11-17/h2-4,7-8,14-15H,5-6,9-12,17H2,1H3,(H,18,20)/t14-,15+/m0/s1.
What are the key properties of 2-amino-N-[(1S,2R)-2-[benzyl(methyl)amino]cyclohexyl]acetamide?
2-amino-N-[(1S,2R)-2-[benzyl(methyl)amino]cyclohexyl]acetamide has a molecular weight of 275.40 g/mol, XLogP of 1.50, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-[(1S,2R)-2-[benzyl(methyl)amino]cyclohexyl]acetamide is sourced from PubChem (CID 96554230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).