C22H29ClN3O+ — CID 9346720
2-[4-(2-chlorophenyl)piperazin-1-ium-1-yl]-N-[(1S)-1-phenylbutyl]acetamide (PubChem CID 9346720) has the molecular formula C22H29ClN3O+ and a molecular weight of 386.95 g/mol. Its IUPAC name is 2-[4-(2-chlorophenyl)piperazin-1-ium-1-yl]-N-[(1S)-1-phenylbutyl]acetamide.
| Compound Name | 2-[4-(2-chlorophenyl)piperazin-1-ium-1-yl]-N-[(1S)-1-phenylbutyl]acetamide |
|---|---|
| PubChem CID | 9346720 |
| Molecular Formula | C22H29ClN3O+ |
| Molecular Weight | 386.95 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 2-[4-(2-chlorophenyl)piperazin-1-ium-1-yl]-N-[(1S)-1-phenylbutyl]acetamide |
| SMILES | CCC[C@H](NC(=O)C[NH+]1CCN(c2ccccc2Cl)CC1)c1ccccc1 |
| InChI | InChI=1S/C22H28ClN3O/c1-2-8-20(18-9-4-3-5-10-18)24-22(27)17-25-13-15-26(16-14-25)21-12-7-6-11-19(21)23/h3-7,9-12,20H,2,8,13-17H2,1H3,(H,24,27)/p+1/t20-/m0/s1 |
| InChIKey | XGQXFAQNSXADRM-FQEVSTJZSA-O |
| XLogP | 2.70 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.95 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |