C20H25ClN3O2S+ — CID 9020769
N-(2-chlorophenyl)-2-[4-(4-thiophen-2-ylbutanoyl)piperazin-1-ium-1-yl]acetamide (PubChem CID 9020769) has the molecular formula C20H25ClN3O2S+ and a molecular weight of 406.96 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[4-(4-thiophen-2-ylbutanoyl)piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(2-chlorophenyl)-2-[4-(4-thiophen-2-ylbutanoyl)piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 9020769 |
| Molecular Formula | C20H25ClN3O2S+ |
| Molecular Weight | 406.96 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | N-(2-chlorophenyl)-2-[4-(4-thiophen-2-ylbutanoyl)piperazin-1-ium-1-yl]acetamide |
| SMILES | O=C(C[NH+]1CCN(C(=O)CCCc2cccs2)CC1)Nc1ccccc1Cl |
| InChI | InChI=1S/C20H24ClN3O2S/c21-17-7-1-2-8-18(17)22-19(25)15-23-10-12-24(13-11-23)20(26)9-3-5-16-6-4-14-27-16/h1-2,4,6-8,14H,3,5,9-13,15H2,(H,22,25)/p+1 |
| InChIKey | VKDDGTLIDRKJIU-UHFFFAOYSA-O |
| XLogP | 2.09 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.96 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |