C21H26N3O4+ — CID 8529311
ethyl 4-[[2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]acetyl]amino]benzoate (PubChem CID 8529311) has the molecular formula C21H26N3O4+ and a molecular weight of 384.46 g/mol. Its IUPAC name is ethyl 4-[[2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 8529311 |
| Molecular Formula | C21H26N3O4+ |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | ethyl 4-[[2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C[NH+]2CCN(c3ccccc3O)CC2)cc1 |
| InChI | InChI=1S/C21H25N3O4/c1-2-28-21(27)16-7-9-17(10-8-16)22-20(26)15-23-11-13-24(14-12-23)18-5-3-4-6-19(18)25/h3-10,25H,2,11-15H2,1H3,(H,22,26)/p+1 |
| InChIKey | COFNSZLVEFPTSM-UHFFFAOYSA-O |
| XLogP | 0.91 |
| TPSA | 83.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |