C24H32N3O4+ — CID 8687835
butyl 4-[[2-[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]acetyl]amino]benzoate (PubChem CID 8687835) has the molecular formula C24H32N3O4+ and a molecular weight of 426.54 g/mol. Its IUPAC name is butyl 4-[[2-[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]acetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 8687835 |
| Molecular Formula | C24H32N3O4+ |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | butyl 4-[[2-[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)C[NH+]2CCN(c3ccccc3OC)CC2)cc1 |
| InChI | InChI=1S/C24H31N3O4/c1-3-4-17-31-24(29)19-9-11-20(12-10-19)25-23(28)18-26-13-15-27(16-14-26)21-7-5-6-8-22(21)30-2/h5-12H,3-4,13-18H2,1-2H3,(H,25,28)/p+1 |
| InChIKey | GBGKUZHMWOHCMI-UHFFFAOYSA-O |
| XLogP | 2.00 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|