C22H28N3O4+ — CID 8529003
propan-2-yl 4-[[2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]acetyl]amino]benzoate (PubChem CID 8529003) has the molecular formula C22H28N3O4+ and a molecular weight of 398.48 g/mol. Its IUPAC name is propan-2-yl 4-[[2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]acetyl]amino]benzoate.
| Compound Name | propan-2-yl 4-[[2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 8529003 |
| Molecular Formula | C22H28N3O4+ |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | propan-2-yl 4-[[2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]acetyl]amino]benzoate |
| SMILES | CC(C)OC(=O)c1ccc(NC(=O)C[NH+]2CCN(c3ccccc3O)CC2)cc1 |
| InChI | InChI=1S/C22H27N3O4/c1-16(2)29-22(28)17-7-9-18(10-8-17)23-21(27)15-24-11-13-25(14-12-24)19-5-3-4-6-20(19)26/h3-10,16,26H,11-15H2,1-2H3,(H,23,27)/p+1 |
| InChIKey | AOKXDMIFVGTKDX-UHFFFAOYSA-O |
| XLogP | 1.30 |
| TPSA | 83.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |