C17H27N4O3+ — CID 8690331
N-[[(2S)-butan-2-yl]carbamoyl]-2-[4-(4-hydroxyphenyl)piperazin-1-ium-1-yl]acetamide (PubChem CID 8690331) has the molecular formula C17H27N4O3+ and a molecular weight of 335.43 g/mol. Its IUPAC name is N-[[(2S)-butan-2-yl]carbamoyl]-2-[4-(4-hydroxyphenyl)piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-[[(2S)-butan-2-yl]carbamoyl]-2-[4-(4-hydroxyphenyl)piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8690331 |
| Molecular Formula | C17H27N4O3+ |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | N-[[(2S)-butan-2-yl]carbamoyl]-2-[4-(4-hydroxyphenyl)piperazin-1-ium-1-yl]acetamide |
| SMILES | CC[C@H](C)NC(=O)NC(=O)C[NH+]1CCN(c2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C17H26N4O3/c1-3-13(2)18-17(24)19-16(23)12-20-8-10-21(11-9-20)14-4-6-15(22)7-5-14/h4-7,13,22H,3,8-12H2,1-2H3,(H2,18,19,23,24)/p+1/t13-/m0/s1 |
| InChIKey | KBWUPLJEDVBQJM-ZDUSSCGKSA-O |
| XLogP | -0.28 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |