C11H22N3O3+ — CID 8903819
N-[[(2R)-butan-2-yl]carbamoyl]-2-morpholin-4-ium-4-ylacetamide (PubChem CID 8903819) has the molecular formula C11H22N3O3+ and a molecular weight of 244.31 g/mol. Its IUPAC name is N-[[(2R)-butan-2-yl]carbamoyl]-2-morpholin-4-ium-4-ylacetamide.
| Compound Name | N-[[(2R)-butan-2-yl]carbamoyl]-2-morpholin-4-ium-4-ylacetamide |
|---|---|
| PubChem CID | 8903819 |
| Molecular Formula | C11H22N3O3+ |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | N-[[(2R)-butan-2-yl]carbamoyl]-2-morpholin-4-ium-4-ylacetamide |
| SMILES | CC[C@@H](C)NC(=O)NC(=O)C[NH+]1CCOCC1 |
| InChI | InChI=1S/C11H21N3O3/c1-3-9(2)12-11(16)13-10(15)8-14-4-6-17-7-5-14/h9H,3-8H2,1-2H3,(H2,12,13,15,16)/p+1/t9-/m1/s1 |
| InChIKey | QFZMGQFWJATRQZ-SECBINFHSA-O |
| XLogP | -1.47 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |