C14H26N4O4 — CID 8711763
N-[[(2R)-butan-2-yl]carbamoyl]-2-[methyl-(2-morpholin-4-yl-2-oxoethyl)amino]acetamide (PubChem CID 8711763) has the molecular formula C14H26N4O4 and a molecular weight of 314.39 g/mol. Its IUPAC name is N-[[(2R)-butan-2-yl]carbamoyl]-2-[methyl-(2-morpholin-4-yl-2-oxoethyl)amino]acetamide.
| Compound Name | N-[[(2R)-butan-2-yl]carbamoyl]-2-[methyl-(2-morpholin-4-yl-2-oxoethyl)amino]acetamide |
|---|---|
| PubChem CID | 8711763 |
| Molecular Formula | C14H26N4O4 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | N-[[(2R)-butan-2-yl]carbamoyl]-2-[methyl-(2-morpholin-4-yl-2-oxoethyl)amino]acetamide |
| SMILES | CC[C@@H](C)NC(=O)NC(=O)CN(C)CC(=O)N1CCOCC1 |
| InChI | InChI=1S/C14H26N4O4/c1-4-11(2)15-14(21)16-12(19)9-17(3)10-13(20)18-5-7-22-8-6-18/h11H,4-10H2,1-3H3,(H2,15,16,19,21)/t11-/m1/s1 |
| InChIKey | DKYLWOYNYQXXCB-LLVKDONJSA-N |
| XLogP | -0.60 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |