C16H20O4 — CID 3632241
(3,3-dimethyl-2-oxobutyl) 3-(2-methoxyphenyl)prop-2-enoate (PubChem CID 3632241) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is (3,3-dimethyl-2-oxobutyl) 3-(2-methoxyphenyl)prop-2-enoate.
| Compound Name | (3,3-dimethyl-2-oxobutyl) 3-(2-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 3632241 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | (3,3-dimethyl-2-oxobutyl) 3-(2-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccccc1C=CC(=O)OCC(=O)C(C)(C)C |
| InChI | InChI=1S/C16H20O4/c1-16(2,3)14(17)11-20-15(18)10-9-12-7-5-6-8-13(12)19-4/h5-10H,11H2,1-4H3 |
| InChIKey | JDHLOQPYRWXNOV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|