C23H26FNO5 — CID 7571527
[2-[cyclohexyl-[(4-fluorophenyl)methyl]amino]-2-oxoethyl] 2-hydroxy-5-methoxybenzoate (PubChem CID 7571527) has the molecular formula C23H26FNO5 and a molecular weight of 415.46 g/mol. Its IUPAC name is [2-[cyclohexyl-[(4-fluorophenyl)methyl]amino]-2-oxoethyl] 2-hydroxy-5-methoxybenzoate.
| Compound Name | [2-[cyclohexyl-[(4-fluorophenyl)methyl]amino]-2-oxoethyl] 2-hydroxy-5-methoxybenzoate |
|---|---|
| PubChem CID | 7571527 |
| Molecular Formula | C23H26FNO5 |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | [2-[cyclohexyl-[(4-fluorophenyl)methyl]amino]-2-oxoethyl] 2-hydroxy-5-methoxybenzoate |
| SMILES | COc1ccc(O)c(C(=O)OCC(=O)N(Cc2ccc(F)cc2)C2CCCCC2)c1 |
| InChI | InChI=1S/C23H26FNO5/c1-29-19-11-12-21(26)20(13-19)23(28)30-15-22(27)25(18-5-3-2-4-6-18)14-16-7-9-17(24)10-8-16/h7-13,18,26H,2-6,14-15H2,1H3 |
| InChIKey | JTOBDVZWSRYIIZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |