C22H23FN2O5 — CID 7505892
[2-[cyclohexyl-[(4-fluorophenyl)methyl]amino]-2-oxoethyl] 4-nitrobenzoate (PubChem CID 7505892) has the molecular formula C22H23FN2O5 and a molecular weight of 414.43 g/mol. Its IUPAC name is [2-[cyclohexyl-[(4-fluorophenyl)methyl]amino]-2-oxoethyl] 4-nitrobenzoate.
| Compound Name | [2-[cyclohexyl-[(4-fluorophenyl)methyl]amino]-2-oxoethyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 7505892 |
| Molecular Formula | C22H23FN2O5 |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | [2-[cyclohexyl-[(4-fluorophenyl)methyl]amino]-2-oxoethyl] 4-nitrobenzoate |
| SMILES | O=C(OCC(=O)N(Cc1ccc(F)cc1)C1CCCCC1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H23FN2O5/c23-18-10-6-16(7-11-18)14-24(19-4-2-1-3-5-19)21(26)15-30-22(27)17-8-12-20(13-9-17)25(28)29/h6-13,19H,1-5,14-15H2 |
| InChIKey | VSUZIOZRSZKFJG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|